C30H35IN2O — CID 173292040
(E)-3-[3-(2,5-dimethylphenyl)phenyl]-N-[4-(1-piperidin-1-ylethyl)phenyl]prop-2-enamide;hydroiodide (PubChem CID 173292040) has the molecular formula C30H35IN2O and a molecular weight of 566.53 g/mol. Its IUPAC name is (E)-3-[3-(2,5-dimethylphenyl)phenyl]-N-[4-(1-piperidin-1-ylethyl)phenyl]prop-2-enamide;hydroiodide.
| Compound Name | (E)-3-[3-(2,5-dimethylphenyl)phenyl]-N-[4-(1-piperidin-1-ylethyl)phenyl]prop-2-enamide;hydroiodide |
|---|---|
| PubChem CID | 173292040 |
| Molecular Formula | C30H35IN2O |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | (E)-3-[3-(2,5-dimethylphenyl)phenyl]-N-[4-(1-piperidin-1-ylethyl)phenyl]prop-2-enamide;hydroiodide |
| SMILES | Cc1ccc(C)c(-c2cccc(/C=C/C(=O)Nc3ccc(C(C)N4CCCCC4)cc3)c2)c1.I |
| InChI | InChI=1S/C30H34N2O.HI/c1-22-10-11-23(2)29(20-22)27-9-7-8-25(21-27)12-17-30(33)31-28-15-13-26(14-16-28)24(3)32-18-5-4-6-19-32;/h7-17,20-21,24H,4-6,18-19H2,1-3H3,(H,31,33);1H/b17-12+; |
| InChIKey | YMHURQAUHMTCOR-KCUXUEJTSA-N |
| XLogP | 7.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|