C28H30IN3O3 — CID 173291386
(E)-3-[3-(3-nitrophenyl)phenyl]-N-[4-(1-piperidin-1-ylethyl)phenyl]prop-2-enamide;hydroiodide (PubChem CID 173291386) has the molecular formula C28H30IN3O3 and a molecular weight of 583.47 g/mol. Its IUPAC name is (E)-3-[3-(3-nitrophenyl)phenyl]-N-[4-(1-piperidin-1-ylethyl)phenyl]prop-2-enamide;hydroiodide.
| Compound Name | (E)-3-[3-(3-nitrophenyl)phenyl]-N-[4-(1-piperidin-1-ylethyl)phenyl]prop-2-enamide;hydroiodide |
|---|---|
| PubChem CID | 173291386 |
| Molecular Formula | C28H30IN3O3 |
| Molecular Weight | 583.47 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | (E)-3-[3-(3-nitrophenyl)phenyl]-N-[4-(1-piperidin-1-ylethyl)phenyl]prop-2-enamide;hydroiodide |
| SMILES | CC(c1ccc(NC(=O)/C=C/c2cccc(-c3cccc([N+](=O)[O-])c3)c2)cc1)N1CCCCC1.I |
| InChI | InChI=1S/C28H29N3O3.HI/c1-21(30-17-3-2-4-18-30)23-12-14-26(15-13-23)29-28(32)16-11-22-7-5-8-24(19-22)25-9-6-10-27(20-25)31(33)34;/h5-16,19-21H,2-4,17-18H2,1H3,(H,29,32);1H/b16-11+; |
| InChIKey | VCIRPGCKGYPJBF-YFMOEUEHSA-N |
| XLogP | 7.08 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.47 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|