C30H35IN2O — CID 173163114
3-[3-(2,5-dimethylphenyl)phenyl]-N-[4-[(1-methylpiperidin-1-ium-1-yl)methyl]phenyl]prop-2-enamide iodide (PubChem CID 173163114) has the molecular formula C30H35IN2O and a molecular weight of 566.53 g/mol. Its IUPAC name is 3-[3-(2,5-dimethylphenyl)phenyl]-N-[4-[(1-methylpiperidin-1-ium-1-yl)methyl]phenyl]prop-2-enamide iodide.
| Compound Name | 3-[3-(2,5-dimethylphenyl)phenyl]-N-[4-[(1-methylpiperidin-1-ium-1-yl)methyl]phenyl]prop-2-enamide iodide |
|---|---|
| PubChem CID | 173163114 |
| Molecular Formula | C30H35IN2O |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 3-[3-(2,5-dimethylphenyl)phenyl]-N-[4-[(1-methylpiperidin-1-ium-1-yl)methyl]phenyl]prop-2-enamide iodide |
| SMILES | Cc1ccc(C)c(-c2cccc(C=CC(=O)Nc3ccc(C[N+]4(C)CCCCC4)cc3)c2)c1.[I-] |
| InChI | InChI=1S/C30H34N2O.HI/c1-23-10-11-24(2)29(20-23)27-9-7-8-25(21-27)14-17-30(33)31-28-15-12-26(13-16-28)22-32(3)18-5-4-6-19-32;/h7-17,20-21H,4-6,18-19,22H2,1-3H3;1H |
| InChIKey | MVGBIQDYVBKGOJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|