C21H24BrClN2O2 — CID 42632918
(E)-3-(3-bromophenyl)-N-[4-[(4-methylmorpholin-4-ium-4-yl)methyl]phenyl]prop-2-enamide chloride (PubChem CID 42632918) has the molecular formula C21H24BrClN2O2 and a molecular weight of 451.79 g/mol. Its IUPAC name is (E)-3-(3-bromophenyl)-N-[4-[(4-methylmorpholin-4-ium-4-yl)methyl]phenyl]prop-2-enamide chloride.
| Compound Name | (E)-3-(3-bromophenyl)-N-[4-[(4-methylmorpholin-4-ium-4-yl)methyl]phenyl]prop-2-enamide chloride |
|---|---|
| PubChem CID | 42632918 |
| Molecular Formula | C21H24BrClN2O2 |
| Molecular Weight | 451.79 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | (E)-3-(3-bromophenyl)-N-[4-[(4-methylmorpholin-4-ium-4-yl)methyl]phenyl]prop-2-enamide chloride |
| SMILES | C[N+]1(Cc2ccc(NC(=O)/C=C/c3cccc(Br)c3)cc2)CCOCC1.[Cl-] |
| InChI | InChI=1S/C21H23BrN2O2.ClH/c1-24(11-13-26-14-12-24)16-18-5-8-20(9-6-18)23-21(25)10-7-17-3-2-4-19(22)15-17;/h2-10,15H,11-14,16H2,1H3;1H/b10-7+; |
| InChIKey | BPJJNUYVTLBKDX-HCUGZAAXSA-N |
| XLogP | 1.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.79 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|