C15H10BrCl2NO — CID 6158871
(E)-3-(3-bromophenyl)-N-(3,5-dichlorophenyl)prop-2-enamide (PubChem CID 6158871) has the molecular formula C15H10BrCl2NO and a molecular weight of 371.06 g/mol. Its IUPAC name is (E)-3-(3-bromophenyl)-N-(3,5-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-bromophenyl)-N-(3,5-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6158871 |
| Molecular Formula | C15H10BrCl2NO |
| Molecular Weight | 371.06 g/mol |
| Exact Mass | 368.93 |
| IUPAC Name | (E)-3-(3-bromophenyl)-N-(3,5-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Br)c1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H10BrCl2NO/c16-11-3-1-2-10(6-11)4-5-15(20)19-14-8-12(17)7-13(18)9-14/h1-9H,(H,19,20)/b5-4+ |
| InChIKey | JCYPLOQMBNNZBT-SNAWJCMRSA-N |
| XLogP | 5.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.06 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|