C16H12Cl2N2O2 — CID 24555546
3-[[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]amino]benzamide (PubChem CID 24555546) has the molecular formula C16H12Cl2N2O2 and a molecular weight of 335.19 g/mol. Its IUPAC name is 3-[[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | 3-[[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 24555546 |
| Molecular Formula | C16H12Cl2N2O2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 3-[[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]amino]benzamide |
| SMILES | NC(=O)c1cccc(NC(=O)/C=C/c2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C16H12Cl2N2O2/c17-12-6-10(7-13(18)9-12)4-5-15(21)20-14-3-1-2-11(8-14)16(19)22/h1-9H,(H2,19,22)(H,20,21)/b5-4+ |
| InChIKey | XQFNXPHYIRMINZ-SNAWJCMRSA-N |
| XLogP | 3.74 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|