C16H11Cl2N5O — CID 24555485
(E)-3-(3,5-dichlorophenyl)-N-[3-(tetrazol-1-yl)phenyl]prop-2-enamide (PubChem CID 24555485) has the molecular formula C16H11Cl2N5O and a molecular weight of 360.20 g/mol. Its IUPAC name is (E)-3-(3,5-dichlorophenyl)-N-[3-(tetrazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-dichlorophenyl)-N-[3-(tetrazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24555485 |
| Molecular Formula | C16H11Cl2N5O |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | (E)-3-(3,5-dichlorophenyl)-N-[3-(tetrazol-1-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)cc(Cl)c1)Nc1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C16H11Cl2N5O/c17-12-6-11(7-13(18)8-12)4-5-16(24)20-14-2-1-3-15(9-14)23-10-19-21-22-23/h1-10H,(H,20,24)/b5-4+ |
| InChIKey | CFXVGJBHUSIWGQ-SNAWJCMRSA-N |
| XLogP | 3.62 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|