C17H15N7O2 — CID 75533166
N-methyl-5-[(E)-3-oxo-3-[3-(tetrazol-1-yl)anilino]prop-1-enyl]pyridine-3-carboxamide (PubChem CID 75533166) has the molecular formula C17H15N7O2 and a molecular weight of 349.35 g/mol. Its IUPAC name is N-methyl-5-[(E)-3-oxo-3-[3-(tetrazol-1-yl)anilino]prop-1-enyl]pyridine-3-carboxamide.
| Compound Name | N-methyl-5-[(E)-3-oxo-3-[3-(tetrazol-1-yl)anilino]prop-1-enyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 75533166 |
| Molecular Formula | C17H15N7O2 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-methyl-5-[(E)-3-oxo-3-[3-(tetrazol-1-yl)anilino]prop-1-enyl]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1cncc(/C=C/C(=O)Nc2cccc(-n3cnnn3)c2)c1 |
| InChI | InChI=1S/C17H15N7O2/c1-18-17(26)13-7-12(9-19-10-13)5-6-16(25)21-14-3-2-4-15(8-14)24-11-20-22-23-24/h2-11H,1H3,(H,18,26)(H,21,25)/b6-5+ |
| InChIKey | YZZPSHFZRSWPAI-AATRIKPKSA-N |
| XLogP | 1.07 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|