C23H26F3IN2O2 — CID 87479388
(E)-N-[[4-[(4-methylmorpholin-4-ium-4-yl)methyl]phenyl]methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide iodide (PubChem CID 87479388) has the molecular formula C23H26F3IN2O2 and a molecular weight of 546.37 g/mol. Its IUPAC name is (E)-N-[[4-[(4-methylmorpholin-4-ium-4-yl)methyl]phenyl]methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide iodide.
| Compound Name | (E)-N-[[4-[(4-methylmorpholin-4-ium-4-yl)methyl]phenyl]methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide iodide |
|---|---|
| PubChem CID | 87479388 |
| Molecular Formula | C23H26F3IN2O2 |
| Molecular Weight | 546.37 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | (E)-N-[[4-[(4-methylmorpholin-4-ium-4-yl)methyl]phenyl]methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide iodide |
| SMILES | C[N+]1(Cc2ccc(CNC(=O)/C=C/c3cccc(C(F)(F)F)c3)cc2)CCOCC1.[I-] |
| InChI | InChI=1S/C23H25F3N2O2.HI/c1-28(11-13-30-14-12-28)17-20-7-5-19(6-8-20)16-27-22(29)10-9-18-3-2-4-21(15-18)23(24,25)26;/h2-10,15H,11-14,16-17H2,1H3;1H/b10-9+; |
| InChIKey | ZNQKFYGLDDGZBG-RRABGKBLSA-N |
| XLogP | 1.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|