C34H27NO3 — CID 67106306
1-(1H-indol-6-yl)-7-(2-phenyl-5-phenylmethoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 67106306) has the molecular formula C34H27NO3 and a molecular weight of 497.59 g/mol. Its IUPAC name is 1-(1H-indol-6-yl)-7-(2-phenyl-5-phenylmethoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | 1-(1H-indol-6-yl)-7-(2-phenyl-5-phenylmethoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 67106306 |
| Molecular Formula | C34H27NO3 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 1-(1H-indol-6-yl)-7-(2-phenyl-5-phenylmethoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | O=C(C=Cc1ccc2cc[nH]c2c1)CC(=O)C=Cc1cc(OCc2ccccc2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C34H27NO3/c36-30(15-12-25-11-13-28-19-20-35-34(28)21-25)23-31(37)16-14-29-22-32(38-24-26-7-3-1-4-8-26)17-18-33(29)27-9-5-2-6-10-27/h1-22,35H,23-24H2 |
| InChIKey | ABJQECQRJPJDRP-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|