C25H19ClO3 — CID 67106716
(1E,6E)-1-(5-chloro-2-phenylphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 67106716) has the molecular formula C25H19ClO3 and a molecular weight of 402.88 g/mol. Its IUPAC name is (1E,6E)-1-(5-chloro-2-phenylphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-(5-chloro-2-phenylphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 67106716 |
| Molecular Formula | C25H19ClO3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (1E,6E)-1-(5-chloro-2-phenylphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | O=C(/C=C/c1ccc(O)cc1)CC(=O)/C=C/c1cc(Cl)ccc1-c1ccccc1 |
| InChI | InChI=1S/C25H19ClO3/c26-21-10-15-25(19-4-2-1-3-5-19)20(16-21)9-14-24(29)17-23(28)13-8-18-6-11-22(27)12-7-18/h1-16,27H,17H2/b13-8+,14-9+ |
| InChIKey | OWJMQKGPNSKOQU-UQNWOCKMSA-N |
| XLogP | 5.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|