C22H17NO3S — CID 68550459
(1E,6E)-1-(4-hydroxyphenyl)-7-(2-phenyl-1,3-thiazol-4-yl)hepta-1,6-diene-3,5-dione (PubChem CID 68550459) has the molecular formula C22H17NO3S and a molecular weight of 375.45 g/mol. Its IUPAC name is (1E,6E)-1-(4-hydroxyphenyl)-7-(2-phenyl-1,3-thiazol-4-yl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-(4-hydroxyphenyl)-7-(2-phenyl-1,3-thiazol-4-yl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 68550459 |
| Molecular Formula | C22H17NO3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (1E,6E)-1-(4-hydroxyphenyl)-7-(2-phenyl-1,3-thiazol-4-yl)hepta-1,6-diene-3,5-dione |
| SMILES | O=C(/C=C/c1ccc(O)cc1)CC(=O)/C=C/c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H17NO3S/c24-19-10-6-16(7-11-19)8-12-20(25)14-21(26)13-9-18-15-27-22(23-18)17-4-2-1-3-5-17/h1-13,15,24H,14H2/b12-8+,13-9+ |
| InChIKey | WPRGUMMKXOLYPP-QHKWOANTSA-N |
| XLogP | 4.77 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|