C14H13FN2OS — CID 27007322
(E)-N-ethyl-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enamide (PubChem CID 27007322) has the molecular formula C14H13FN2OS and a molecular weight of 276.34 g/mol. Its IUPAC name is (E)-N-ethyl-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-ethyl-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 27007322 |
| Molecular Formula | C14H13FN2OS |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | (E)-N-ethyl-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enamide |
| SMILES | CCNC(=O)/C=C/c1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H13FN2OS/c1-2-16-13(18)8-7-12-9-19-14(17-12)10-3-5-11(15)6-4-10/h3-9H,2H2,1H3,(H,16,18)/b8-7+ |
| InChIKey | VEMSPZSQCCTCRR-BQYQJAHWSA-N |
| XLogP | 3.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|