C19H13ClFN3O2S — CID 24531755
2-chloro-N'-[(E)-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enoyl]benzohydrazide (PubChem CID 24531755) has the molecular formula C19H13ClFN3O2S and a molecular weight of 401.85 g/mol. Its IUPAC name is 2-chloro-N'-[(E)-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enoyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[(E)-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 24531755 |
| Molecular Formula | C19H13ClFN3O2S |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 2-chloro-N'-[(E)-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enoyl]benzohydrazide |
| SMILES | O=C(/C=C/c1csc(-c2ccc(F)cc2)n1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H13ClFN3O2S/c20-16-4-2-1-3-15(16)18(26)24-23-17(25)10-9-14-11-27-19(22-14)12-5-7-13(21)8-6-12/h1-11H,(H,23,25)(H,24,26)/b10-9+ |
| InChIKey | NWZYUJYPBJPRSG-MDZDMXLPSA-N |
| XLogP | 4.08 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|