C17H12ClN3O2S — CID 78290733
N'-[3-(1,3-benzothiazol-2-yl)prop-2-enoyl]-2-chlorobenzohydrazide (PubChem CID 78290733) has the molecular formula C17H12ClN3O2S and a molecular weight of 357.82 g/mol. Its IUPAC name is N'-[3-(1,3-benzothiazol-2-yl)prop-2-enoyl]-2-chlorobenzohydrazide.
| Compound Name | N'-[3-(1,3-benzothiazol-2-yl)prop-2-enoyl]-2-chlorobenzohydrazide |
|---|---|
| PubChem CID | 78290733 |
| Molecular Formula | C17H12ClN3O2S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | N'-[3-(1,3-benzothiazol-2-yl)prop-2-enoyl]-2-chlorobenzohydrazide |
| SMILES | O=C(C=Cc1nc2ccccc2s1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H12ClN3O2S/c18-12-6-2-1-5-11(12)17(23)21-20-15(22)9-10-16-19-13-7-3-4-8-14(13)24-16/h1-10H,(H,20,22)(H,21,23) |
| InChIKey | IOQYYIQZCPUILG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|