C20H20N4O2S — CID 7923213
(E)-3-(1,3-benzothiazol-2-yl)-N'-[2-(2,4-dimethylanilino)acetyl]prop-2-enehydrazide (PubChem CID 7923213) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N'-[2-(2,4-dimethylanilino)acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N'-[2-(2,4-dimethylanilino)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 7923213 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N'-[2-(2,4-dimethylanilino)acetyl]prop-2-enehydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)/C=C/c2nc3ccccc3s2)c(C)c1 |
| InChI | InChI=1S/C20H20N4O2S/c1-13-7-8-15(14(2)11-13)21-12-19(26)24-23-18(25)9-10-20-22-16-5-3-4-6-17(16)27-20/h3-11,21H,12H2,1-2H3,(H,23,25)(H,24,26)/b10-9+ |
| InChIKey | MBTOGQUOLASKNO-MDZDMXLPSA-N |
| XLogP | 3.19 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|