C20H23N3O2 — CID 9432686
(E)-N'-[2-(2,4-dimethylanilino)acetyl]-3-(4-methylphenyl)prop-2-enehydrazide (PubChem CID 9432686) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is (E)-N'-[2-(2,4-dimethylanilino)acetyl]-3-(4-methylphenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(2,4-dimethylanilino)acetyl]-3-(4-methylphenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 9432686 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (E)-N'-[2-(2,4-dimethylanilino)acetyl]-3-(4-methylphenyl)prop-2-enehydrazide |
| SMILES | Cc1ccc(/C=C/C(=O)NNC(=O)CNc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C20H23N3O2/c1-14-4-7-17(8-5-14)9-11-19(24)22-23-20(25)13-21-18-10-6-15(2)12-16(18)3/h4-12,21H,13H2,1-3H3,(H,22,24)(H,23,25)/b11-9+ |
| InChIKey | VTMPINSIIDJUPS-PKNBQFBNSA-N |
| XLogP | 2.88 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|