C18H20ClN3O2 — CID 7923263
2-(4-chlorophenyl)-N'-[2-(2,4-dimethylanilino)acetyl]acetohydrazide (PubChem CID 7923263) has the molecular formula C18H20ClN3O2 and a molecular weight of 345.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N'-[2-(2,4-dimethylanilino)acetyl]acetohydrazide.
| Compound Name | 2-(4-chlorophenyl)-N'-[2-(2,4-dimethylanilino)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 7923263 |
| Molecular Formula | C18H20ClN3O2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-(4-chlorophenyl)-N'-[2-(2,4-dimethylanilino)acetyl]acetohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)Cc2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C18H20ClN3O2/c1-12-3-8-16(13(2)9-12)20-11-18(24)22-21-17(23)10-14-4-6-15(19)7-5-14/h3-9,20H,10-11H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | AYTJNWCFYDDTHM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|