C18H20Cl2N2O — CID 109006978
N-[2-(2,4-dichlorophenyl)ethyl]-2-(2,4-dimethylanilino)acetamide (PubChem CID 109006978) has the molecular formula C18H20Cl2N2O and a molecular weight of 351.28 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2-(2,4-dimethylanilino)acetamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(2,4-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 109006978 |
| Molecular Formula | C18H20Cl2N2O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(2,4-dimethylanilino)acetamide |
| SMILES | Cc1ccc(NCC(=O)NCCc2ccc(Cl)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C18H20Cl2N2O/c1-12-3-6-17(13(2)9-12)22-11-18(23)21-8-7-14-4-5-15(19)10-16(14)20/h3-6,9-10,22H,7-8,11H2,1-2H3,(H,21,23) |
| InChIKey | ZCANMALUUZUDSA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |