C19H20FN3O2 — CID 9432147
(E)-N'-[2-(2,4-dimethylanilino)acetyl]-3-(2-fluorophenyl)prop-2-enehydrazide (PubChem CID 9432147) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is (E)-N'-[2-(2,4-dimethylanilino)acetyl]-3-(2-fluorophenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(2,4-dimethylanilino)acetyl]-3-(2-fluorophenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 9432147 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | (E)-N'-[2-(2,4-dimethylanilino)acetyl]-3-(2-fluorophenyl)prop-2-enehydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)/C=C/c2ccccc2F)c(C)c1 |
| InChI | InChI=1S/C19H20FN3O2/c1-13-7-9-17(14(2)11-13)21-12-19(25)23-22-18(24)10-8-15-5-3-4-6-16(15)20/h3-11,21H,12H2,1-2H3,(H,22,24)(H,23,25)/b10-8+ |
| InChIKey | VOFMXXLWUQPJHG-CSKARUKUSA-N |
| XLogP | 2.72 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|