C18H14ClN3O3S — CID 35929815
N'-(2-chlorobenzoyl)-2-(4-methoxyphenyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 35929815) has the molecular formula C18H14ClN3O3S and a molecular weight of 387.85 g/mol. Its IUPAC name is N'-(2-chlorobenzoyl)-2-(4-methoxyphenyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-(2-chlorobenzoyl)-2-(4-methoxyphenyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 35929815 |
| Molecular Formula | C18H14ClN3O3S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | N'-(2-chlorobenzoyl)-2-(4-methoxyphenyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | COc1ccc(-c2nc(C(=O)NNC(=O)c3ccccc3Cl)cs2)cc1 |
| InChI | InChI=1S/C18H14ClN3O3S/c1-25-12-8-6-11(7-9-12)18-20-15(10-26-18)17(24)22-21-16(23)13-4-2-3-5-14(13)19/h2-10H,1H3,(H,21,23)(H,22,24) |
| InChIKey | DWEYAYVHGDBANH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|