C11H8NO3S- — CID 6933840
2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 6933840) has the molecular formula C11H8NO3S- and a molecular weight of 234.26 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 6933840 |
| Molecular Formula | C11H8NO3S- |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | COc1ccc(-c2nc(C(=O)[O-])cs2)cc1 |
| InChI | InChI=1S/C11H9NO3S/c1-15-8-4-2-7(3-5-8)10-12-9(6-16-10)11(13)14/h2-6H,1H3,(H,13,14)/p-1 |
| InChIKey | OIBLFOXWCGIRIQ-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |