C18H11ClN2O3S — CID 9448007
(E)-3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-1-(2-nitrophenyl)prop-2-en-1-one (PubChem CID 9448007) has the molecular formula C18H11ClN2O3S and a molecular weight of 370.82 g/mol. Its IUPAC name is (E)-3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-1-(2-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-1-(2-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9448007 |
| Molecular Formula | C18H11ClN2O3S |
| Molecular Weight | 370.82 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | (E)-3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-1-(2-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1csc(-c2ccc(Cl)cc2)n1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H11ClN2O3S/c19-13-7-5-12(6-8-13)18-20-14(11-25-18)9-10-17(22)15-3-1-2-4-16(15)21(23)24/h1-11H/b10-9+ |
| InChIKey | AQSDTLLFTBZFPK-MDZDMXLPSA-N |
| XLogP | 5.27 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.82 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|