C18H13NO2S — CID 163050348
1-(4-hydroxyphenyl)-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one (PubChem CID 163050348) has the molecular formula C18H13NO2S and a molecular weight of 307.37 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one.
| Compound Name | 1-(4-hydroxyphenyl)-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 163050348 |
| Molecular Formula | C18H13NO2S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 1-(4-hydroxyphenyl)-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1csc(-c2ccccc2)n1)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H13NO2S/c20-16-9-6-13(7-10-16)17(21)11-8-15-12-22-18(19-15)14-4-2-1-3-5-14/h1-12,20H |
| InChIKey | QORCOCBUUGZTBP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|