C12H9NOS — CID 101014013
(E)-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-enal (PubChem CID 101014013) has the molecular formula C12H9NOS and a molecular weight of 215.28 g/mol. Its IUPAC name is (E)-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-enal.
| Compound Name | (E)-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-enal |
|---|---|
| PubChem CID | 101014013 |
| Molecular Formula | C12H9NOS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | (E)-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-enal |
| SMILES | O=C/C=C/c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H9NOS/c14-8-4-7-11-9-15-12(13-11)10-5-2-1-3-6-10/h1-9H/b7-4+ |
| InChIKey | JTNDCBWXSFDNHI-QPJJXVBHSA-N |
| XLogP | 3.02 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|