C9H7NOS — CID 568728
2-phenyl-1,3-thiazol-4-ol (PubChem CID 568728) has the molecular formula C9H7NOS and a molecular weight of 177.23 g/mol. Its IUPAC name is 2-phenyl-1,3-thiazol-4-ol.
| Compound Name | 2-phenyl-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 568728 |
| Molecular Formula | C9H7NOS |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | 2-phenyl-1,3-thiazol-4-ol |
| SMILES | Oc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H7NOS/c11-8-6-12-9(10-8)7-4-2-1-3-5-7/h1-6,11H |
| InChIKey | CCMLIFHRMDXEBM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |