C11H12N2OS — CID 14076241
2-amino-1-(2-phenyl-1,3-thiazol-4-yl)ethanol (PubChem CID 14076241) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-amino-1-(2-phenyl-1,3-thiazol-4-yl)ethanol.
| Compound Name | 2-amino-1-(2-phenyl-1,3-thiazol-4-yl)ethanol |
|---|---|
| PubChem CID | 14076241 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-amino-1-(2-phenyl-1,3-thiazol-4-yl)ethanol |
| SMILES | NCC(O)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C11H12N2OS/c12-6-10(14)9-7-15-11(13-9)8-4-2-1-3-5-8/h1-5,7,10,14H,6,12H2 |
| InChIKey | MAGSISQNLPDBEG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |