C14H15NO3S — CID 102139996
ethyl (3R)-3-hydroxy-3-(2-phenyl-1,3-thiazol-4-yl)propanoate (PubChem CID 102139996) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is ethyl (3R)-3-hydroxy-3-(2-phenyl-1,3-thiazol-4-yl)propanoate.
| Compound Name | ethyl (3R)-3-hydroxy-3-(2-phenyl-1,3-thiazol-4-yl)propanoate |
|---|---|
| PubChem CID | 102139996 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | ethyl (3R)-3-hydroxy-3-(2-phenyl-1,3-thiazol-4-yl)propanoate |
| SMILES | CCOC(=O)C[C@@H](O)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H15NO3S/c1-2-18-13(17)8-12(16)11-9-19-14(15-11)10-6-4-3-5-7-10/h3-7,9,12,16H,2,8H2,1H3/t12-/m1/s1 |
| InChIKey | FXDNFHHRBSEUGY-GFCCVEGCSA-N |
| XLogP | 2.80 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |