C20H17FN2O3S — CID 99609548
ethyl 2-(2-fluoro-N-(2-phenyl-1,3-thiazole-4-carbonyl)anilino)acetate (PubChem CID 99609548) has the molecular formula C20H17FN2O3S and a molecular weight of 384.43 g/mol. Its IUPAC name is ethyl 2-(2-fluoro-N-(2-phenyl-1,3-thiazole-4-carbonyl)anilino)acetate.
| Compound Name | ethyl 2-(2-fluoro-N-(2-phenyl-1,3-thiazole-4-carbonyl)anilino)acetate |
|---|---|
| PubChem CID | 99609548 |
| Molecular Formula | C20H17FN2O3S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | ethyl 2-(2-fluoro-N-(2-phenyl-1,3-thiazole-4-carbonyl)anilino)acetate |
| SMILES | CCOC(=O)CN(C(=O)c1csc(-c2ccccc2)n1)c1ccccc1F |
| InChI | InChI=1S/C20H17FN2O3S/c1-2-26-18(24)12-23(17-11-7-6-10-15(17)21)20(25)16-13-27-19(22-16)14-8-4-3-5-9-14/h3-11,13H,2,12H2,1H3 |
| InChIKey | SEKUVIYTVPCYJP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |