C16H10FNOS — CID 25259516
(2-fluorophenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone (PubChem CID 25259516) has the molecular formula C16H10FNOS and a molecular weight of 283.33 g/mol. Its IUPAC name is (2-fluorophenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone.
| Compound Name | (2-fluorophenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 25259516 |
| Molecular Formula | C16H10FNOS |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | (2-fluorophenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1csc(-c2ccccc2)n1)c1ccccc1F |
| InChI | InChI=1S/C16H10FNOS/c17-13-9-5-4-8-12(13)15(19)14-10-20-16(18-14)11-6-2-1-3-7-11/h1-10H |
| InChIKey | RDTZJRPENYAVNK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |