(Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid

C13H11NO2S — CID 58657658

IUPAC(Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid
SMILESC/C=C(\C(=O)O)c1csc(-c2ccccc2)n1
InChIInChI=1S/C13H11NO2S/c1-2-10(13(15)16)11-8-17-12(14-11)9-6-4-3-5-7-9/h2-8H,1H3,(H,15,16)/b10-2-
InChIKeyMIKUQBXOJBERID-SGAXSIHGSA-N
MW245.30 g/mol
LogP3.30
Rot. Bonds3

About (Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid

(Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid (PubChem CID 58657658) has the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. Its IUPAC name is (Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid.

Molecular Properties

Compound Name(Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid
PubChem CID58657658
Molecular FormulaC13H11NO2S
Molecular Weight245.30 g/mol
Exact Mass245.05
IUPAC Name(Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid
SMILESC/C=C(\C(=O)O)c1csc(-c2ccccc2)n1
InChIInChI=1S/C13H11NO2S/c1-2-10(13(15)16)11-8-17-12(14-11)9-6-4-3-5-7-9/h2-8H,1H3,(H,15,16)/b10-2-
InChIKeyMIKUQBXOJBERID-SGAXSIHGSA-N
XLogP3.30
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.30
LogP ≤ 53.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid?
The IUPAC name of (Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid (CID 58657658) is (Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid.
What is the SMILES notation for (Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid?
The canonical SMILES for (Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid is C/C=C(\C(=O)O)c1csc(-c2ccccc2)n1.
What is the InChIKey of (Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid?
The InChIKey is MIKUQBXOJBERID-SGAXSIHGSA-N. The full InChI is InChI=1S/C13H11NO2S/c1-2-10(13(15)16)11-8-17-12(14-11)9-6-4-3-5-7-9/h2-8H,1H3,(H,15,16)/b10-2-.
What are the key properties of (Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid?
(Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid has a molecular weight of 245.30 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(2-phenyl-1,3-thiazol-4-yl)but-2-enoic acid is sourced from PubChem (CID 58657658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).