C14H18N2OS — CID 116890712
2-amino-1-[2-(2,3,4-trimethylphenyl)-1,3-thiazol-4-yl]ethanol (PubChem CID 116890712) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is 2-amino-1-[2-(2,3,4-trimethylphenyl)-1,3-thiazol-4-yl]ethanol.
| Compound Name | 2-amino-1-[2-(2,3,4-trimethylphenyl)-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 116890712 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-amino-1-[2-(2,3,4-trimethylphenyl)-1,3-thiazol-4-yl]ethanol |
| SMILES | Cc1ccc(-c2nc(C(O)CN)cs2)c(C)c1C |
| InChI | InChI=1S/C14H18N2OS/c1-8-4-5-11(10(3)9(8)2)14-16-12(7-18-14)13(17)6-15/h4-5,7,13,17H,6,15H2,1-3H3 |
| InChIKey | JGQMAFQIBVQHIQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |