About CID 172941484
CID 172941484 (PubChem CID 172941484) has the molecular formula C11H9N4SSe
and a molecular weight of 308.25 g/mol.
Molecular Properties
| Compound Name | CID 172941484 |
| PubChem CID | 172941484 |
| Molecular Formula | C11H9N4SSe |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | — |
| SMILES | NC([Se])=N/N=C/c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C11H9N4SSe/c12-11(17)15-13-6-9-7-16-10(14-9)8-4-2-1-3-5-8/h1-7H,(H2,12,15)/b13-6+ |
| InChIKey | WAYNBAXSAGQTAL-AWNIVKPZSA-N |
| XLogP | 1.63 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 172941484 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172941484?
The IUPAC name of CID 172941484 (CID 172941484) is not available.
What is the SMILES notation for CID 172941484?
The canonical SMILES for CID 172941484 is NC([Se])=N/N=C/c1csc(-c2ccccc2)n1.
What is the InChIKey of CID 172941484?
The InChIKey is WAYNBAXSAGQTAL-AWNIVKPZSA-N. The full InChI is InChI=1S/C11H9N4SSe/c12-11(17)15-13-6-9-7-16-10(14-9)8-4-2-1-3-5-8/h1-7H,(H2,12,15)/b13-6+.
What are the key properties of CID 172941484?
CID 172941484 has a molecular weight of 308.25 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172941484 is sourced from PubChem (CID 172941484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).