C10H8N2OS — CID 174971038
N-(2-phenyl-1,3-thiazol-4-yl)formamide (PubChem CID 174971038) has the molecular formula C10H8N2OS and a molecular weight of 204.25 g/mol. Its IUPAC name is N-(2-phenyl-1,3-thiazol-4-yl)formamide.
| Compound Name | N-(2-phenyl-1,3-thiazol-4-yl)formamide |
|---|---|
| PubChem CID | 174971038 |
| Molecular Formula | C10H8N2OS |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | N-(2-phenyl-1,3-thiazol-4-yl)formamide |
| SMILES | O=CNc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C10H8N2OS/c13-7-11-9-6-14-10(12-9)8-4-2-1-3-5-8/h1-7H,(H,11,13) |
| InChIKey | JIYDPSCWGXYFAY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|