C8H9NOS — CID 131233241
(E)-3-(2-ethyl-1,3-thiazol-4-yl)prop-2-enal (PubChem CID 131233241) has the molecular formula C8H9NOS and a molecular weight of 167.23 g/mol. Its IUPAC name is (E)-3-(2-ethyl-1,3-thiazol-4-yl)prop-2-enal.
| Compound Name | (E)-3-(2-ethyl-1,3-thiazol-4-yl)prop-2-enal |
|---|---|
| PubChem CID | 131233241 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | (E)-3-(2-ethyl-1,3-thiazol-4-yl)prop-2-enal |
| SMILES | CCc1nc(/C=C/C=O)cs1 |
| InChI | InChI=1S/C8H9NOS/c1-2-8-9-7(6-11-8)4-3-5-10/h3-6H,2H2,1H3/b4-3+ |
| InChIKey | CGSKEGGSVFSSDS-ONEGZZNKSA-N |
| XLogP | 1.92 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|