About 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one
3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one (PubChem CID 78905646) has the molecular formula C16H10N2O4S
and a molecular weight of 326.33 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one.
Molecular Properties
| Compound Name | 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one |
| PubChem CID | 78905646 |
| Molecular Formula | C16H10N2O4S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1csc(-c2ccco2)n1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H10N2O4S/c19-14(11-3-6-13(7-4-11)18(20)21)8-5-12-10-23-16(17-12)15-2-1-9-22-15/h1-10H |
| InChIKey | GQKQESQETGVQJB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one?
The IUPAC name of 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one (CID 78905646) is 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one.
What is the SMILES notation for 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one?
The canonical SMILES for 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one is O=C(C=Cc1csc(-c2ccco2)n1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one?
The InChIKey is GQKQESQETGVQJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O4S/c19-14(11-3-6-13(7-4-11)18(20)21)8-5-12-10-23-16(17-12)15-2-1-9-22-15/h1-10H.
What are the key properties of 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one?
3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one has a molecular weight of 326.33 g/mol, XLogP of 4.21, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one is sourced from PubChem (CID 78905646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).