C16H10N2O4S — CID 78905646
3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one (PubChem CID 78905646) has the molecular formula C16H10N2O4S and a molecular weight of 326.33 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one.
| Compound Name | 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 78905646 |
| Molecular Formula | C16H10N2O4S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-1-(4-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1csc(-c2ccco2)n1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H10N2O4S/c19-14(11-3-6-13(7-4-11)18(20)21)8-5-12-10-23-16(17-12)15-2-1-9-22-15/h1-10H |
| InChIKey | GQKQESQETGVQJB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|