C17H14N2O4S2 — CID 72684481
N-[4-[3-[2-(furan-2-yl)-1,3-thiazol-4-yl]prop-2-enoyl]phenyl]methanesulfonamide (PubChem CID 72684481) has the molecular formula C17H14N2O4S2 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-[4-[3-[2-(furan-2-yl)-1,3-thiazol-4-yl]prop-2-enoyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[3-[2-(furan-2-yl)-1,3-thiazol-4-yl]prop-2-enoyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 72684481 |
| Molecular Formula | C17H14N2O4S2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | N-[4-[3-[2-(furan-2-yl)-1,3-thiazol-4-yl]prop-2-enoyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)C=Cc2csc(-c3ccco3)n2)cc1 |
| InChI | InChI=1S/C17H14N2O4S2/c1-25(21,22)19-13-6-4-12(5-7-13)15(20)9-8-14-11-24-17(18-14)16-3-2-10-23-16/h2-11,19H,1H3 |
| InChIKey | QQUXLHQVHYBGNN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|