C19H15FN2O3S2 — CID 72684489
N-[4-[3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enoyl]phenyl]methanesulfonamide (PubChem CID 72684489) has the molecular formula C19H15FN2O3S2 and a molecular weight of 402.47 g/mol. Its IUPAC name is N-[4-[3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enoyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enoyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 72684489 |
| Molecular Formula | C19H15FN2O3S2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | N-[4-[3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enoyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)C=Cc2csc(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C19H15FN2O3S2/c1-27(24,25)22-16-8-4-13(5-9-16)18(23)11-10-17-12-26-19(21-17)14-2-6-15(20)7-3-14/h2-12,22H,1H3 |
| InChIKey | BSOVFYGFRXPCPO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|