C15H11FN2O3S2 — CID 167476558
2-(4-fluorophenyl)-N-(4-hydroxyphenyl)-1,3-thiazole-4-sulfonamide (PubChem CID 167476558) has the molecular formula C15H11FN2O3S2 and a molecular weight of 350.40 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(4-hydroxyphenyl)-1,3-thiazole-4-sulfonamide.
| Compound Name | 2-(4-fluorophenyl)-N-(4-hydroxyphenyl)-1,3-thiazole-4-sulfonamide |
|---|---|
| PubChem CID | 167476558 |
| Molecular Formula | C15H11FN2O3S2 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(4-hydroxyphenyl)-1,3-thiazole-4-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(O)cc1)c1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H11FN2O3S2/c16-11-3-1-10(2-4-11)15-17-14(9-22-15)23(20,21)18-12-5-7-13(19)8-6-12/h1-9,18-19H |
| InChIKey | QADXZGQGRYJIER-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|