C16H12N2O4S2 — CID 167475368
4-[(2-phenyl-1,3-thiazol-4-yl)sulfonylamino]benzoic acid (PubChem CID 167475368) has the molecular formula C16H12N2O4S2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 4-[(2-phenyl-1,3-thiazol-4-yl)sulfonylamino]benzoic acid.
| Compound Name | 4-[(2-phenyl-1,3-thiazol-4-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 167475368 |
| Molecular Formula | C16H12N2O4S2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 4-[(2-phenyl-1,3-thiazol-4-yl)sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C16H12N2O4S2/c19-16(20)12-6-8-13(9-7-12)18-24(21,22)14-10-23-15(17-14)11-4-2-1-3-5-11/h1-10,18H,(H,19,20) |
| InChIKey | LMIKIEURHPARPY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |