C18H13N3O5S2 — CID 168726500
4-[[2-(3-isocyanophenyl)-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid (PubChem CID 168726500) has the molecular formula C18H13N3O5S2 and a molecular weight of 415.45 g/mol. Its IUPAC name is 4-[[2-(3-isocyanophenyl)-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid.
| Compound Name | 4-[[2-(3-isocyanophenyl)-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 168726500 |
| Molecular Formula | C18H13N3O5S2 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | 4-[[2-(3-isocyanophenyl)-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid |
| SMILES | [C-]#[N+]c1cccc(-c2nc(S(=O)(=O)Nc3ccc(C(=O)O)cc3OC)cs2)c1 |
| InChI | InChI=1S/C18H13N3O5S2/c1-19-13-5-3-4-11(8-13)17-20-16(10-27-17)28(24,25)21-14-7-6-12(18(22)23)9-15(14)26-2/h3-10,21H,2H3,(H,22,23) |
| InChIKey | CPSITFYSIYOQCM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|