C18H16FN3O5S2 — CID 167476420
4-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]sulfonylamino]-N-hydroxy-3-methoxy-N-methylbenzamide (PubChem CID 167476420) has the molecular formula C18H16FN3O5S2 and a molecular weight of 437.47 g/mol. Its IUPAC name is 4-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]sulfonylamino]-N-hydroxy-3-methoxy-N-methylbenzamide.
| Compound Name | 4-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]sulfonylamino]-N-hydroxy-3-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 167476420 |
| Molecular Formula | C18H16FN3O5S2 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 4-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]sulfonylamino]-N-hydroxy-3-methoxy-N-methylbenzamide |
| SMILES | COc1cc(C(=O)N(C)O)ccc1NS(=O)(=O)c1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H16FN3O5S2/c1-22(24)18(23)12-5-8-14(15(9-12)27-2)21-29(25,26)16-10-28-17(20-16)11-3-6-13(19)7-4-11/h3-10,21,24H,1-2H3 |
| InChIKey | JTYDJIKSKZLYRY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|