C15H11FN2O4S2 — CID 167475542
N-(2,4-dihydroxyphenyl)-2-(4-fluorophenyl)-1,3-thiazole-4-sulfonamide (PubChem CID 167475542) has the molecular formula C15H11FN2O4S2 and a molecular weight of 366.40 g/mol. Its IUPAC name is N-(2,4-dihydroxyphenyl)-2-(4-fluorophenyl)-1,3-thiazole-4-sulfonamide.
| Compound Name | N-(2,4-dihydroxyphenyl)-2-(4-fluorophenyl)-1,3-thiazole-4-sulfonamide |
|---|---|
| PubChem CID | 167475542 |
| Molecular Formula | C15H11FN2O4S2 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | N-(2,4-dihydroxyphenyl)-2-(4-fluorophenyl)-1,3-thiazole-4-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(O)cc1O)c1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H11FN2O4S2/c16-10-3-1-9(2-4-10)15-17-14(8-23-15)24(21,22)18-12-6-5-11(19)7-13(12)20/h1-8,18-20H |
| InChIKey | WLFFYKWPLUIQTI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|