C19H14N2O6S2 — CID 167476217
4-[[2-[2-(4-hydroxyphenyl)ethynyl]-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid (PubChem CID 167476217) has the molecular formula C19H14N2O6S2 and a molecular weight of 430.46 g/mol. Its IUPAC name is 4-[[2-[2-(4-hydroxyphenyl)ethynyl]-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid.
| Compound Name | 4-[[2-[2-(4-hydroxyphenyl)ethynyl]-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 167476217 |
| Molecular Formula | C19H14N2O6S2 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 4-[[2-[2-(4-hydroxyphenyl)ethynyl]-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NS(=O)(=O)c1csc(C#Cc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C19H14N2O6S2/c1-27-16-10-13(19(23)24)5-8-15(16)21-29(25,26)18-11-28-17(20-18)9-4-12-2-6-14(22)7-3-12/h2-3,5-8,10-11,21-22H,1H3,(H,23,24) |
| InChIKey | ADFHSWODOBCTKD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|