C20H13F3N2O4S2 — CID 167475311
3-methoxy-4-[[2-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,3-thiazol-4-yl]sulfanylamino]benzoic acid (PubChem CID 167475311) has the molecular formula C20H13F3N2O4S2 and a molecular weight of 466.46 g/mol. Its IUPAC name is 3-methoxy-4-[[2-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,3-thiazol-4-yl]sulfanylamino]benzoic acid.
| Compound Name | 3-methoxy-4-[[2-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,3-thiazol-4-yl]sulfanylamino]benzoic acid |
|---|---|
| PubChem CID | 167475311 |
| Molecular Formula | C20H13F3N2O4S2 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | 3-methoxy-4-[[2-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,3-thiazol-4-yl]sulfanylamino]benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NSc1csc(C#Cc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C20H13F3N2O4S2/c1-28-16-10-13(19(26)27)5-8-15(16)25-31-18-11-30-17(24-18)9-4-12-2-6-14(7-3-12)29-20(21,22)23/h2-3,5-8,10-11,25H,1H3,(H,26,27) |
| InChIKey | XDOYUXLTLUYWQK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|