C23H24N2O3S2 — CID 167476127
4-[[2-(3-cyclohexylphenyl)-1,3-thiazol-4-yl]sulfanylamino]-3-methoxybenzoic acid (PubChem CID 167476127) has the molecular formula C23H24N2O3S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 4-[[2-(3-cyclohexylphenyl)-1,3-thiazol-4-yl]sulfanylamino]-3-methoxybenzoic acid.
| Compound Name | 4-[[2-(3-cyclohexylphenyl)-1,3-thiazol-4-yl]sulfanylamino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 167476127 |
| Molecular Formula | C23H24N2O3S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 4-[[2-(3-cyclohexylphenyl)-1,3-thiazol-4-yl]sulfanylamino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NSc1csc(-c2cccc(C3CCCCC3)c2)n1 |
| InChI | InChI=1S/C23H24N2O3S2/c1-28-20-13-18(23(26)27)10-11-19(20)25-30-21-14-29-22(24-21)17-9-5-8-16(12-17)15-6-3-2-4-7-15/h5,8-15,25H,2-4,6-7H2,1H3,(H,26,27) |
| InChIKey | DJMRTGUIKURMKK-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|