C28H30N2O3S — CID 167476156
4-[[4-(4-cyclohexylphenyl)-1,3-dihydroisoindol-2-yl]sulfanylamino]-3-methoxybenzoic acid (PubChem CID 167476156) has the molecular formula C28H30N2O3S and a molecular weight of 474.63 g/mol. Its IUPAC name is 4-[[4-(4-cyclohexylphenyl)-1,3-dihydroisoindol-2-yl]sulfanylamino]-3-methoxybenzoic acid.
| Compound Name | 4-[[4-(4-cyclohexylphenyl)-1,3-dihydroisoindol-2-yl]sulfanylamino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 167476156 |
| Molecular Formula | C28H30N2O3S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 4-[[4-(4-cyclohexylphenyl)-1,3-dihydroisoindol-2-yl]sulfanylamino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NSN1Cc2cccc(-c3ccc(C4CCCCC4)cc3)c2C1 |
| InChI | InChI=1S/C28H30N2O3S/c1-33-27-16-22(28(31)32)14-15-26(27)29-34-30-17-23-8-5-9-24(25(23)18-30)21-12-10-20(11-13-21)19-6-3-2-4-7-19/h5,8-16,19,29H,2-4,6-7,17-18H2,1H3,(H,31,32) |
| InChIKey | BJMJQFGZRPPYGB-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|