C22H19FN2O3S — CID 167476538
4-[[5-(4-fluorophenyl)-1,3-dihydroisoindol-2-yl]sulfanylamino]-3-methoxybenzoic acid (PubChem CID 167476538) has the molecular formula C22H19FN2O3S and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-[[5-(4-fluorophenyl)-1,3-dihydroisoindol-2-yl]sulfanylamino]-3-methoxybenzoic acid.
| Compound Name | 4-[[5-(4-fluorophenyl)-1,3-dihydroisoindol-2-yl]sulfanylamino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 167476538 |
| Molecular Formula | C22H19FN2O3S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 4-[[5-(4-fluorophenyl)-1,3-dihydroisoindol-2-yl]sulfanylamino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NSN1Cc2ccc(-c3ccc(F)cc3)cc2C1 |
| InChI | InChI=1S/C22H19FN2O3S/c1-28-21-11-16(22(26)27)6-9-20(21)24-29-25-12-17-3-2-15(10-18(17)13-25)14-4-7-19(23)8-5-14/h2-11,24H,12-13H2,1H3,(H,26,27) |
| InChIKey | QFEJDTFORFRLSR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|