C26H22N2O6S2 — CID 167476539
4-[[7-(4-carboxy-2-methoxyanilino)sulfanylnaphthalen-2-yl]sulfanylamino]-3-methoxybenzoic acid (PubChem CID 167476539) has the molecular formula C26H22N2O6S2 and a molecular weight of 522.60 g/mol. Its IUPAC name is 4-[[7-(4-carboxy-2-methoxyanilino)sulfanylnaphthalen-2-yl]sulfanylamino]-3-methoxybenzoic acid.
| Compound Name | 4-[[7-(4-carboxy-2-methoxyanilino)sulfanylnaphthalen-2-yl]sulfanylamino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 167476539 |
| Molecular Formula | C26H22N2O6S2 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | 4-[[7-(4-carboxy-2-methoxyanilino)sulfanylnaphthalen-2-yl]sulfanylamino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NSc1ccc2ccc(SNc3ccc(C(=O)O)cc3OC)cc2c1 |
| InChI | InChI=1S/C26H22N2O6S2/c1-33-23-13-16(25(29)30)5-9-21(23)27-35-19-7-3-15-4-8-20(12-18(15)11-19)36-28-22-10-6-17(26(31)32)14-24(22)34-2/h3-14,27-28H,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | UEJMSVMJQWNTOE-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|