C27H24F2N2O3S2 — CID 167476384
4-[[2-[7-(4,4-difluorocyclohexyl)naphthalen-2-yl]-1,3-thiazol-4-yl]sulfanylamino]-3-methoxybenzoic acid (PubChem CID 167476384) has the molecular formula C27H24F2N2O3S2 and a molecular weight of 526.63 g/mol. Its IUPAC name is 4-[[2-[7-(4,4-difluorocyclohexyl)naphthalen-2-yl]-1,3-thiazol-4-yl]sulfanylamino]-3-methoxybenzoic acid.
| Compound Name | 4-[[2-[7-(4,4-difluorocyclohexyl)naphthalen-2-yl]-1,3-thiazol-4-yl]sulfanylamino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 167476384 |
| Molecular Formula | C27H24F2N2O3S2 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 4-[[2-[7-(4,4-difluorocyclohexyl)naphthalen-2-yl]-1,3-thiazol-4-yl]sulfanylamino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NSc1csc(-c2ccc3ccc(C4CCC(F)(F)CC4)cc3c2)n1 |
| InChI | InChI=1S/C27H24F2N2O3S2/c1-34-23-14-20(26(32)33)6-7-22(23)31-36-24-15-35-25(30-24)19-5-3-16-2-4-18(12-21(16)13-19)17-8-10-27(28,29)11-9-17/h2-7,12-15,17,31H,8-11H2,1H3,(H,32,33) |
| InChIKey | WZBGKMKEWQOYCU-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|